ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39493-62-4 Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate |
|
상품명칭 | Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate |
영문 이름 | Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate;5,6-Dihydroorsellinic acid methyl ester~4-Hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate methyl ester~Methyl 5-methylcyclohexene-1,3-dione-4-carboxylate;methyl 4-hydroxy-6-methyl-2-oxocyclohex-3-ene-1-carboxylate |
분자식 | C9H12O4 |
분자량 | 184.1892 |
InChI | InChI=1/C9H12O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h4-5,8,10H,3H2,1-2H3 |
cas번호 | 39493-62-4 |
분자 구조 | |
밀도 | 1.237g/cm3 |
비등점 | 289.4°C at 760 mmHg |
굴절 지수 | 1.511 |
인화점 | 113°C |
증기압 | 0.000243mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |