Chemindex > 39493-62-4
KR ▼
39493-62-4 Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate |
|
| 상품명칭 | Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate |
| 영문 이름 | Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate;5,6-Dihydroorsellinic acid methyl ester~4-Hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate methyl ester~Methyl 5-methylcyclohexene-1,3-dione-4-carboxylate;methyl 4-hydroxy-6-methyl-2-oxocyclohex-3-ene-1-carboxylate |
| 분자식 | C9H12O4 |
| 분자량 | 184.1892 |
| InChI | InChI=1/C9H12O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h4-5,8,10H,3H2,1-2H3 |
| cas번호 | 39493-62-4 |
| 분자 구조 |  |
| 밀도 | 1.237g/cm3 |
| 비등점 | 289.4°C at 760 mmHg |
| 굴절 지수 | 1.511 |
| 인화점 | 113°C |
| 증기압 | 0.000243mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
39493-62-4 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 