ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38690-76-5 4-시아노페닐 4-헵틸벤조에이트 |
|
상품명칭 | 4-시아노페닐 4-헵틸벤조에이트 |
별명 | ; 4-n-헵틸벤조산 4-시아노페닐 에스테르; |
영문 이름 | 4-Cyanophenyl 4-heptylbenzoate;4-n-Heptylbenzoic acid 4-Cyanophenyl ester |
분자식 | C21H23NO2 |
분자량 | 321.4128 |
InChI | InChI=1/C21H23NO2/c1-2-3-4-5-6-7-17-8-12-19(13-9-17)21(23)24-20-14-10-18(16-22)11-15-20/h8-15H,2-7H2,1H3 |
cas번호 | 38690-76-5 |
EC번호 | 254-084-0 |
분자 구조 | |
밀도 | 1.09g/cm3 |
녹는 점 | 43-45℃ |
비등점 | 476.4°C at 760 mmHg |
굴절 지수 | 1.56 |
인화점 | 238.3°C |
증기압 | 3.07E-09mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |