ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
35696-77-6 2,4-Dimethoxyphenylthiourea |
|
상품명칭 | 2,4-Dimethoxyphenylthiourea |
영문 이름 | 2,4-Dimethoxyphenylthiourea;1-(2,4-DIMETHOXYPHENYL)-2-THIOUREA;1-(2,4-dimethoxyphenyl)thiourea |
분자식 | C9H12N2O2S |
분자량 | 212.2688 |
InChI | InChI=1/C9H12N2O2S/c1-12-6-3-4-7(11-9(10)14)8(5-6)13-2/h3-5H,1-2H3,(H3,10,11,14) |
cas번호 | 35696-77-6 |
분자 구조 | |
밀도 | 1.282g/cm3 |
비등점 | 352.5°C at 760 mmHg |
굴절 지수 | 1.645 |
인화점 | 167°C |
증기압 | 3.83E-05mmHg at 25°C |
리스크 규칙 | R25##Toxic if swallowed.:; |
보안 규칙 | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |