Chemindex > 347-55-7
KR ▼
347-55-7 2-(trifluoromethylthio)aniline |
|
| 상품명칭 | 2-(trifluoromethylthio)aniline |
| 영문 이름 | 2-(trifluoromethylthio)aniline;2-Aminophenyl trifluoromethyl sulphide;4-(3-fluoro-4-methoxyphenyl)-4-oxobutanoic acid |
| 분자식 | C11H11FO4 |
| 분자량 | 226.201 |
| InChI | InChI=1/C11H11FO4/c1-16-10-4-2-7(6-8(10)12)9(13)3-5-11(14)15/h2,4,6H,3,5H2,1H3,(H,14,15) |
| cas번호 | 347-55-7 |
| EC번호 | 206-473-1 |
| 분자 구조 |  |
| 밀도 | 1.279g/cm3 |
| 비등점 | 422.6°C at 760 mmHg |
| 굴절 지수 | 1.52 |
| 인화점 | 209.4°C |
| 증기압 | 6.78E-08mmHg at 25°C |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 