Chemindex > 344-14-9
KR ▼
344-14-9 dimethyl fluoromalonate |
|
| 상품명칭 | dimethyl fluoromalonate |
| 영문 이름 | dimethyl fluoromalonate;Fluoromalonic acid dimethyl ester;dimethyl fluoropropanedioate;2-Fluoro-malonic acid dimethyl ester |
| 분자식 | C5H7FO4 |
| 분자량 | 150.1051 |
| InChI | InChI=1/C5H7FO4/c1-9-4(7)3(6)5(8)10-2/h3H,1-2H3 |
| cas번호 | 344-14-9 |
| 분자 구조 |  |
| 밀도 | 1.211g/cm3 |
| 비등점 | 140.3°C at 760 mmHg |
| 굴절 지수 | 1.382 |
| 인화점 | 38.4°C |
| 증기압 | 6.18mmHg at 25°C |
| 리스크 규칙 | R34##Causes burns.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.ChemNet Mall을 방문하여
dimethyl fluoromalonate 344-14-9 의 가격에 대해 문의하십시오.
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 