ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
343-27-1 Harmine hydrochloride hydrate |
|
상품명칭 | Harmine hydrochloride hydrate |
영문 이름 | Harmine hydrochloride hydrate;7-Methoxy-1-methyl-9H-pyrido[3,4-b]indole hydrochloride hydrate;Harmine hydrochlorid;Banisterine, Telepathine;7-methoxy-1-methyl-9H-beta-carbolin-9-ium chloride;Harmine Hydrochloride |
분자식 | C13H13ClN2O |
분자량 | 248.7081 |
InChI | InChI=1/C13H12N2O.ClH/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13;/h3-7,15H,1-2H3;1H |
cas번호 | 343-27-1 |
EC번호 | 206-443-8 |
분자 구조 | |
녹는 점 | 265-270℃ |
비등점 | 421.4°C at 760 mmHg |
인화점 | 139.8°C |
증기압 | 6.42E-07mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R40##Possible risks of irreversible effects.:; |
보안 규칙 | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |