ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
341-69-5 Orphenadrine hydrochloride |
|
상품명칭 | Orphenadrine hydrochloride |
영문 이름 | Orphenadrine hydrochloride;N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride;N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1);N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium;N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium |
분자식 | C18H24NO |
분자량 | 270.3887 |
InChI | InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
cas번호 | 341-69-5 |
EC번호 | 206-435-4 |
분자 구조 | ![]() |
녹는 점 | 159-162℃ |
비등점 | 363°C at 760 mmHg |
인화점 | 107.1°C |
증기압 | 1.86E-05mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R20/21##Harmful by inhalation and in contact with skin.:; |
보안 규칙 | S23##Do not inhale gas/fumes/vapour/spray.:; |
MSDS |