ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332121-92-3 2-(Fmoc-amino)-4-chlorobenzoic acid |
|
상품명칭 | 2-(Fmoc-amino)-4-chlorobenzoic acid |
영문 이름 | 2-(Fmoc-amino)-4-chlorobenzoic acid;N-(9-Fluorenylmethoxycarbonyl)-4-chloroanthranilic acid~N-Fmoc-4-chloroanthranilic acid;4-chloro-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}benzoic acid |
분자식 | C22H16ClNO4 |
분자량 | 393.8197 |
InChI | InChI=1/C22H16ClNO4/c23-13-9-10-18(21(25)26)20(11-13)24-22(27)28-12-19-16-7-3-1-5-14(16)15-6-2-4-8-17(15)19/h1-11,19H,12H2,(H,24,27)(H,25,26) |
cas번호 | 332121-92-3 |
분자 구조 | ![]() |
밀도 | 1.418g/cm3 |
비등점 | 555.5°C at 760 mmHg |
굴절 지수 | 1.687 |
인화점 | 289.8°C |
증기압 | 3.54E-13mmHg at 25°C |
리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |