ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-51-4 (4-fluorophenylthio)acetic acid |
|
상품명칭 | (4-fluorophenylthio)acetic acid |
영문 이름 | (4-fluorophenylthio)acetic acid;2-[(4-Fluorophenyl)thio]acetic acid;[(4-fluorophenyl)sulfanyl]acetic acid;[(4-fluorophenyl)sulfanyl]acetate;2-(4-Fluorophenylthio)acetic acid |
분자식 | C8H6FO2S |
분자량 | 185.196 |
InChI | InChI=1/C8H7FO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1 |
cas번호 | 332-51-4 |
분자 구조 | ![]() |
녹는 점 | 76-79℃ |
비등점 | 315.4°C at 760 mmHg |
인화점 | 144.5°C |
증기압 | 0.000185mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |