ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-43-4 1-(2-chloroethyl)-4-fluorobenzene |
|
상품명칭 | 1-(2-chloroethyl)-4-fluorobenzene |
영문 이름 | 1-(2-chloroethyl)-4-fluorobenzene;4-Fluorophenethyl chloride~2-(4-Fluorophenyl)ethyl chloride |
분자식 | C8H8ClF |
분자량 | 158.6005 |
InChI | InChI=1/C8H8ClF/c9-6-5-7-1-3-8(10)4-2-7/h1-4H,5-6H2 |
cas번호 | 332-43-4 |
EC번호 | 206-364-9 |
분자 구조 | |
밀도 | 1.15g/cm3 |
비등점 | 204.6°C at 760 mmHg |
굴절 지수 | 1.501 |
인화점 | 79.9°C |
증기압 | 0.373mmHg at 25°C |
리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |