ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32648-01-4 butyric acid, diester with propane-1,2,3-triol |
|
상품명칭 | butyric acid, diester with propane-1,2,3-triol |
영문 이름 | butyric acid, diester with propane-1,2,3-triol;Dibutyrylglycerol;Butanoic acid, diester with 1,2,3-propanetriol;Butyric acid, diester with propane-1,2,3-triol;2-hydroxypropane-1,3-diyl dibutanoate |
분자식 | C11H20O5 |
분자량 | 232.2735 |
InChI | InChI=1/C11H20O5/c1-3-5-10(13)15-7-9(12)8-16-11(14)6-4-2/h9,12H,3-8H2,1-2H3 |
cas번호 | 32648-01-4 |
EC번호 | 251-139-0 |
분자 구조 | |
밀도 | 1.08g/cm3 |
비등점 | 324°C at 760 mmHg |
굴절 지수 | 1.452 |
인화점 | 115.5°C |
증기압 | 1.98E-05mmHg at 25°C |
MSDS |