5-Fluoro-2-methylphenylhydrazine hydrochloride |
|
상품명칭 | 5-Fluoro-2-methylphenylhydrazine hydrochloride |
영문 이름 | 5-Fluoro-2-methylphenylhydrazine hydrochloride;(5-fluoro-2-methylphenyl)diazanium chloride;(5-fluoro-2-methylphenyl)hydrazine;3-Fluoro-6-methylphenylhydrazine HCl;5-Fluoro-2-methylphenylhydrazine HCl |
분자식 | C7H9FN2 |
분자량 | 140.1582 |
InChI | InChI=1/C7H9FN2/c1-5-2-3-6(8)4-7(5)10-9/h2-4,10H,9H2,1H3 |
cas번호 | 325-50-8 |
분자 구조 | |
밀도 | 1.202g/cm3 |
비등점 | 212°C at 760 mmHg |
굴절 지수 | 1.594 |
인화점 | 82°C |
증기압 | 0.177mmHg at 25°C |
리스크 규칙 | R20/22##Harmful by inhalation and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |