ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
324-42-5 2-플루오로-6-메틸나프탈렌 |
|
상품명칭 | 2-플루오로-6-메틸나프탈렌 |
영문 이름 | 2-fluoro-6-methylnaphthalene; |
분자식 | C11H9F |
분자량 | 160.1876 |
InChI | InChI=1/C11H9F/c1-8-2-3-10-7-11(12)5-4-9(10)6-8/h2-7H,1H3 |
cas번호 | 324-42-5 |
분자 구조 | ![]() |
밀도 | 1.112g/cm3 |
녹는 점 | 72℃ |
비등점 | 247.5°C at 760 mmHg |
굴절 지수 | 1.594 |
인화점 | 84.5°C |
증기압 | 0.0403mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |