ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
322-46-3 Pyrido[2,3-b]pyrazine |
|
상품명칭 | Pyrido[2,3-b]pyrazine |
영문 이름 | Pyrido[2,3-b]pyrazine;1,4,5-Triazanaphthalene;Pyrido(2,3-b)pyrazine;Pyridopyrazine |
분자식 | C7H5N3 |
분자량 | 131.1347 |
InChI | InChI=1/C7H5N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-5H |
cas번호 | 322-46-3 |
EC번호 | 206-294-9 |
분자 구조 | |
밀도 | 1.27g/cm3 |
녹는 점 | 139-143℃ |
비등점 | 253.9°C at 760 mmHg |
굴절 지수 | 1.665 |
인화점 | 115.9°C |
증기압 | 0.0284mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |