ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
32122-11-5 Methyl 4-benzyloxybenzoate |
|
상품명칭 | Methyl 4-benzyloxybenzoate |
영문 이름 | Methyl 4-benzyloxybenzoate;4-Benzyloxybenzoic acid methyl ester |
분자식 | C15H14O3 |
분자량 | 242.2699 |
InChI | InChI=1/C15H14O3/c1-17-15(16)13-7-9-14(10-8-13)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
cas번호 | 32122-11-5 |
분자 구조 | |
밀도 | 1.142g/cm3 |
비등점 | 372.5°C at 760 mmHg |
굴절 지수 | 1.566 |
인화점 | 156.2°C |
증기압 | 9.56E-06mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |