ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
320-65-0 2-fluorobenzal chloride |
|
상품명칭 | 2-fluorobenzal chloride |
영문 이름 | 2-fluorobenzal chloride;alpha,alpha-Dichloro-2-fluorotoluene |
분자식 | C7H5Cl2F |
분자량 | 179.02 |
InChI | InChI=1/C7H5Cl2F/c8-7(9)5-3-1-2-4-6(5)10/h1-4,7H |
cas번호 | 320-65-0 |
EC번호 | 206-279-7 |
분자 구조 | ![]() |
밀도 | 1.3 |
비등점 | 224℃ |
리스크 규칙 | R34##Causes burns.||R36##Irritating to eyes.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |