ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306937-38-2 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
|
상품명칭 | 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
영문 이름 | 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid;2-(2,5-dimethylthiazol-4-yl)acetic acid;(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
분자식 | C7H9NO2S |
분자량 | 171.2169 |
InChI | InChI=1/C7H9NO2S/c1-4-6(3-7(9)10)8-5(2)11-4/h3H2,1-2H3,(H,9,10) |
cas번호 | 306937-38-2 |
분자 구조 | ![]() |
밀도 | 1.295g/cm3 |
녹는 점 | 98℃ |
비등점 | 320.5°C at 760 mmHg |
굴절 지수 | 1.572 |
인화점 | 147.7°C |
증기압 | 0.000131mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |