Chemindex > 306937-38-2
KR ▼
306937-38-2 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
|
| 상품명칭 | 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
| 영문 이름 | 2-(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid;2-(2,5-dimethylthiazol-4-yl)acetic acid;(2,5-dimethyl-1,3-thiazol-4-yl)acetic acid |
| 분자식 | C7H9NO2S |
| 분자량 | 171.2169 |
| InChI | InChI=1/C7H9NO2S/c1-4-6(3-7(9)10)8-5(2)11-4/h3H2,1-2H3,(H,9,10) |
| cas번호 | 306937-38-2 |
| 분자 구조 |  |
| 밀도 | 1.295g/cm3 |
| 녹는 점 | 98℃ |
| 비등점 | 320.5°C at 760 mmHg |
| 굴절 지수 | 1.572 |
| 인화점 | 147.7°C |
| 증기압 | 0.000131mmHg at 25°C |
| 위험성 표시 |  Xi##Irritant:; |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
306937-38-2 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 