ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
305-53-3 Iodoacetic acid, sodium salt |
|
상품명칭 | Iodoacetic acid, sodium salt |
영문 이름 | Iodoacetic acid, sodium salt;Sodium iodoacetate;Iodoacetic acid sodium salt |
분자식 | C2H2INaO2 |
분자량 | 207.9303 |
InChI | InChI=1/C2H3IO2.Na/c3-1-2(4)5;/h1H2,(H,4,5);/q;+1/p-1 |
cas번호 | 305-53-3 |
EC번호 | 206-165-7 |
분자 구조 | ![]() |
녹는 점 | 208-210℃ |
비등점 | 262.1°C at 760 mmHg |
인화점 | 112.3°C |
증기압 | 0.00329mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R25##Toxic if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S22##Do not inhale dust.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |