ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
305-15-7 2,5-Dichlorophenylhydrazine |
|
상품명칭 | 2,5-Dichlorophenylhydrazine |
영문 이름 | 2,5-Dichlorophenylhydrazine ;-2,5-DICHLOROPHENYLHYDRAZINE;1-(2,5-DICHLOROPHENYL)HYDRAZINE;(2,5-dichlorophenyl)-hydrazin;Hydrazine, (2,5-dichlorophenyl)-;2,5-DICHLOROPHENYLHYRAZINE |
분자식 | C6H6Cl2N2 |
분자량 | 177.0312 |
InChI | InChI=1/C6H6Cl2N2/c7-4-1-2-5(8)6(3-4)10-9/h1-3,10H,9H2 |
cas번호 | 305-15-7 |
EC번호 | 206-163-6 |
분자 구조 | ![]() |
밀도 | 1.475g/cm3 |
녹는 점 | 100-104℃ |
비등점 | 266.8°C at 760 mmHg |
굴절 지수 | 1.665 |
인화점 | 115.1°C |
증기압 | 0.00848mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |