ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
29425-97-6 데칸산, 디부틸아민과 화합물 (1:1) |
|
상품명칭 | 데칸산, 디부틸아민과 화합물 (1:1) |
별명 | 데칸산, compd.with N-부틸-1-부탄아민(1:1); 디부틸아민, 데칸산 염; 데칸산, 디부틸아민과 화합물 (1:1); 데칸산 - N- 부틸 부탄 -1- 아민 (1 : 1); |
영문 이름 | decanoic acid, compound with dibutylamine (1:1);Decanoic acid, compd. with N-butyl-1-butanamine (1:1);Dibutylamine, decanoic acid salt;Decanoic acid, compound with dibutylamine (1:1);decanoic acid - N-butylbutan-1-amine (1:1) |
분자식 | C18H39NO2 |
분자량 | 301.5078 |
InChI | InChI=1/C10H20O2.C8H19N/c1-2-3-4-5-6-7-8-9-10(11)12;1-3-5-7-9-8-6-4-2/h2-9H2,1H3,(H,11,12);9H,3-8H2,1-2H3 |
cas번호 | 29425-97-6 |
EC번호 | 249-620-5 |
분자 구조 | ![]() |
비등점 | 269.6°C at 760 mmHg |
인화점 | 121.8°C |
증기압 | 0.00355mmHg at 25°C |
MSDS |