Cyclododecane epoxide |
|
상품명칭 | Cyclododecane epoxide |
영문 이름 | Cyclododecane epoxide;Cyclododecane epoxide, mixture of cis andtrans isomers;Cyclododecene oxide (cis+trans);Cyclododecane oxide;Epoxy N-Dodecane;13-oxabicyclo[10.1.0]tridecane;(1R,12R)-13-oxabicyclo[10.1.0]tridecane;(1R,12S)-13-oxabicyclo[10.1.0]tridecane;(1S,12S)-13-oxabicyclo[10.1.0]tridecane |
분자식 | C12H22O |
분자량 | 182.3025 |
InChI | InChI=1/C12H22O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h11-12H,1-10H2/t11-,12-/m0/s1 |
cas번호 | 286-99-7 |
EC번호 | 206-012-4 |
분자 구조 | |
밀도 | 0.899g/cm3 |
녹는 점 | -7℃ |
비등점 | 237.4°C at 760 mmHg |
굴절 지수 | 1.455 |
인화점 | 82.2°C |
증기압 | 0.0691mmHg at 25°C |
위험성 표시 | Xi##Irritant:; |
리스크 규칙 | R38:; |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |