Cyclooctene oxide |
|
상품명칭 | Cyclooctene oxide |
영문 이름 | Cyclooctene oxide;9-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane~2-Oxabicyclo[6.1.0]nonane;Epoxycyclooctane;(1R,8S)-9-oxabicyclo[6.1.0]nonane;(1R,8R)-9-oxabicyclo[6.1.0]nonane;(1S,8S)-9-oxabicyclo[6.1.0]nonane |
분자식 | C8H14O |
분자량 | 126.1962 |
InChI | InChI=1/C8H14O/c1-2-4-6-8-7(9-8)5-3-1/h7-8H,1-6H2/t7-,8-/m0/s1 |
cas번호 | 286-62-4 |
EC번호 | 206-010-3 |
분자 구조 | |
밀도 | 0.958g/cm3 |
녹는 점 | 53-56℃ |
비등점 | 189.3°C at 760 mmHg |
굴절 지수 | 1.466 |
인화점 | 56.1°C |
증기압 | 0.793mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |