Chemindex > 2777-65-3
KR ▼
2777-65-3 10-Undecynoic acid |
|
| 상품명칭 | 10-Undecynoic acid |
| 영문 이름 | 10-Undecynoic acid; |
| 분자식 | C11H18O2 |
| 분자량 | 182.2594 |
| InChI | InChI=1/C11H18O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h1H,3-10H2,(H,12,13) |
| cas번호 | 2777-65-3 |
| EC번호 | 220-471-8 |
| 분자 구조 |  |
| 밀도 | 0.966g/cm3 |
| 비등점 | 297.7°C at 760 mmHg |
| 굴절 지수 | 1.468 |
| 인화점 | 142.9°C |
| 증기압 | 0.000317mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 