ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
26413-58-1 2-chloro-6-methylpyridine-4-carbonyl chloride |
|
상품명칭 | 2-chloro-6-methylpyridine-4-carbonyl chloride |
영문 이름 | 2-chloro-6-methylpyridine-4-carbonyl chloride; |
분자식 | C7H5Cl2NO |
분자량 | 190.0267 |
InChI | InChI=1/C7H5Cl2NO/c1-4-2-5(7(9)11)3-6(8)10-4/h2-3H,1H3 |
cas번호 | 26413-58-1 |
분자 구조 | ![]() |
밀도 | 1.384g/cm3 |
비등점 | 270.3°C at 760 mmHg |
굴절 지수 | 1.558 |
인화점 | 117.3°C |
증기압 | 0.00688mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |