ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24484-22-8 5-(4'-Fluorophenyl)valeric acid |
|
상품명칭 | 5-(4'-Fluorophenyl)valeric acid |
영문 이름 | 5-(4'-Fluorophenyl)valeric acid;5-(4-Fluorophenyl)valeric acid;5-(4-Fluorophenyl)pentanoic acid;5-(4-fluorophenyl)pentanoate |
분자식 | C11H12FO2 |
분자량 | 195.2107 |
InChI | InChI=1/C11H13FO2/c12-10-7-5-9(6-8-10)3-1-2-4-11(13)14/h5-8H,1-4H2,(H,13,14)/p-1 |
cas번호 | 24484-22-8 |
분자 구조 | ![]() |
녹는 점 | 75-77℃ |
비등점 | 335.6°C at 760 mmHg |
인화점 | 156.8°C |
증기압 | 4.67E-05mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |