ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
2444-68-0 9-Vinylanthracene |
|
상품명칭 | 9-Vinylanthracene |
영문 이름 | 9-Vinylanthracene;9-Ethenylanthracen;Anthracene, 9-ethenyl- (9CI);9-ethenylanthracene |
분자식 | C16H12 |
분자량 | 204.2665 |
InChI | InChI=1/C16H12/c1-2-14-15-9-5-3-7-12(15)11-13-8-4-6-10-16(13)14/h2-11H,1H2 |
cas번호 | 2444-68-0 |
EC번호 | 219-486-2 |
분자 구조 | ![]() |
밀도 | 1.112g/cm3 |
녹는 점 | 64-66℃ |
비등점 | 377°C at 760 mmHg |
굴절 지수 | 1.724 |
인화점 | 172.4°C |
증기압 | 1.51E-05mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |