ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
23328-66-7 2,6- 디 (옥시란 -2- 일 메틸) -1,2,3,5,6,7- 헥사 히드로 피 롤로 [3,4-f] 이소 인돌 -1,3,5,7- 테트라 온 |
|
상품명칭 | 2,6- 디 (옥시란 -2- 일 메틸) -1,2,3,5,6,7- 헥사 히드로 피 롤로 [3,4-f] 이소 인돌 -1,3,5,7- 테트라 온 |
별명 | ; 2,6- 디 (옥시란 -2- 일 메틸) -1,2,3,5,6,7- 헥사 히드로 피 롤로 [3,4-f] 이소 인돌 -1,3,5,7- 테트라; 2,6- 비스 (옥시란 -2- 일 메틸) 피 롤로 [3,4-f] 이소 인돌 -1,3,5,7 (2H, 6H)- 테트론; |
영문 이름 | 2,6-di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetraone;2,6-Di(oxiran-2-ylmethyl)-1,2,3,5,6,7-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetra;2,6-bis(oxiran-2-ylmethyl)pyrrolo[3,4-f]isoindole-1,3,5,7(2H,6H)-tetrone |
분자식 | C16H12N2O6 |
분자량 | 328.2763 |
InChI | InChI=1/C16H12N2O6/c19-13-9-1-10-12(16(22)18(14(10)20)4-8-6-24-8)2-11(9)15(21)17(13)3-7-5-23-7/h1-2,7-8H,3-6H2 |
cas번호 | 23328-66-7 |
분자 구조 | |
밀도 | 1.713g/cm3 |
비등점 | 570.4°C at 760 mmHg |
굴절 지수 | 1.725 |
인화점 | 298.8°C |
증기압 | 5.04E-13mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |