ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
229-87-8 Phenanthridine |
|
상품명칭 | Phenanthridine |
영문 이름 | Phenanthridine;Phenanthridine;3,4-Benzoquinoline;Phenanthridine, (Benzo[c]quinoline) |
분자식 | C13H9N |
분자량 | 179.2173 |
InChI | InChI=1/C13H9N/c1-2-6-12-10(4-1)7-8-11-5-3-9-14-13(11)12/h1-9H |
cas번호 | 229-87-8 |
EC번호 | 205-934-4 |
분자 구조 | ![]() |
밀도 | 1.187g/cm3 |
녹는 점 | 104-107℃ |
비등점 | 340.8°C at 760 mmHg |
굴절 지수 | 1.726 |
인화점 | 155.9°C |
증기압 | 0.000166mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R40##Possible risks of irreversible effects.:; |
보안 규칙 | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |