Chemindex > 22047-88-7
KR ▼
22047-88-7 2-Benzyloxyphenylacetic acid |
|
| 상품명칭 | 2-Benzyloxyphenylacetic acid |
| 영문 이름 | 2-Benzyloxyphenylacetic acid;[2-(phenoxymethyl)phenyl]acetic acid |
| 분자식 | C15H14O3 |
| 분자량 | 242.2699 |
| InChI | InChI=1/C15H14O3/c16-15(17)10-12-6-4-5-7-13(12)11-18-14-8-2-1-3-9-14/h1-9H,10-11H2,(H,16,17) |
| cas번호 | 22047-88-7 |
| 분자 구조 |  |
| 밀도 | 1.201g/cm3 |
| 비등점 | 408.9°C at 760 mmHg |
| 굴절 지수 | 1.595 |
| 인화점 | 154.1°C |
| 증기압 | 2.03E-07mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 