ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216394-07-9 (1S,2S)-(+)-2-Benzyloxycyclohexylamine |
|
상품명칭 | (1S,2S)-(+)-2-Benzyloxycyclohexylamine |
영문 이름 | (1S,2S)-(+)-2-Benzyloxycyclohexylamine;(1S,2S)-(+)-1-Amino-2-benzyloxycyclohexane~(1S-trans)-(+)-2-(Phenylmethoxy)cyclohexanamine;(1S-trans)-2-(Phenylmethoxy)cyclohexaneamine;(1S,2S)-2-(benzyloxy)cyclohexanamine |
분자식 | C13H19NO |
분자량 | 205.2961 |
InChI | InChI=1/C13H19NO/c14-12-8-4-5-9-13(12)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10,14H2/t12-,13-/m0/s1 |
cas번호 | 216394-07-9 |
분자 구조 | ![]() |
밀도 | 1.039g/cm3 |
비등점 | 306.148°C at 760 mmHg |
굴절 지수 | 1.545 |
인화점 | 133.224°C |
증기압 | 0.001mmHg at 25°C |
리스크 규칙 | R34##Causes burns.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |