1,2,3,4-Dibenzanthracene |
|
상품명칭 | 1,2,3,4-Dibenzanthracene |
영문 이름 | 1,2,3,4-Dibenzanthracene;Dibenz[a,c]anthracene;dibenz(a,c)anthracene;1,2:3,4-dibenzanthracene;Benztriphenylene;2,3-Benztriphenylene;benzo[f]tetraphene |
분자식 | C22H14 |
분자량 | 278.3466 |
InChI | InChI=1/C22H14/c1-2-8-16-14-22-20-12-6-4-10-18(20)17-9-3-5-11-19(17)21(22)13-15(16)7-1/h1-14H |
cas번호 | 215-58-7 |
EC번호 | 205-920-8 |
분자 구조 | |
밀도 | 1.232g/cm3 |
녹는 점 | 202-207℃ |
비등점 | 518°C at 760 mmHg |
굴절 지수 | 1.811 |
인화점 | 264.5°C |
증기압 | 2.55E-10mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R40##Possible risks of irreversible effects.:; |
보안 규칙 | S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |