ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
1643-15-8 (m-Tolyloxy)-acetic acid |
|
상품명칭 | (m-Tolyloxy)-acetic acid |
영문 이름 | (m-Tolyloxy)-acetic acid;3-Methylphenoxyacetic acid;(3-methylphenoxy)acetic acid;(3-methylphenoxy)acetate |
분자식 | C9H9O3 |
분자량 | 165.1665 |
InChI | InChI=1/C9H10O3/c1-7-3-2-4-8(5-7)12-6-9(10)11/h2-5H,6H2,1H3,(H,10,11)/p-1 |
cas번호 | 1643-15-8 |
EC번호 | 216-698-7 |
분자 구조 | |
비등점 | 300°C at 760 mmHg |
인화점 | 121.4°C |
증기압 | 0.000512mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |