ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
16215-21-7 Butyl 3-mercaptopropionate |
|
상품명칭 | Butyl 3-mercaptopropionate |
영문 이름 | Butyl 3-mercaptopropionate;Propanoic acid, 3-mercapto-, butyl ester;Butyl mercaptopropionate;NSC 54830;beta-Mercaptopropionic acid, butyl ester;Propionic acid, 3-mercapto-, butyl ester;butyl 3-sulfanylpropanoate |
분자식 | C7H14O2S |
분자량 | 162.2499 |
InChI | InChI=1/C7H14O2S/c1-2-3-5-9-7(8)4-6-10/h10H,2-6H2,1H3 |
cas번호 | 16215-21-7 |
EC번호 | 240-343-5 |
분자 구조 | ![]() |
밀도 | 1.003g/cm3 |
비등점 | 216.9°C at 760 mmHg |
굴절 지수 | 1.458 |
인화점 | 93.3°C |
증기압 | 0.136mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |