Chemindex > 14922-36-2
KR ▼
14922-36-2 4-Nitrophenylglyoxylic acid |
|
| 상품명칭 | 4-Nitrophenylglyoxylic acid |
| 영문 이름 | 4-Nitrophenylglyoxylic acid;4-Nitrobenzoylformic acid;(4-nitrophenyl)(oxo)acetic acid |
| 분자식 | C8H5NO5 |
| 분자량 | 195.129 |
| InChI | InChI=1/C8H5NO5/c10-7(8(11)12)5-1-3-6(4-2-5)9(13)14/h1-4H,(H,11,12) |
| cas번호 | 14922-36-2 |
| 분자 구조 |  |
| 밀도 | 1.531g/cm3 |
| 비등점 | 381.6°C at 760 mmHg |
| 굴절 지수 | 1.613 |
| 인화점 | 173.1°C |
| 증기압 | 1.67E-06mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
14922-36-2 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 