Chemindex > 13679-72-6
KR ▼
13679-72-6 2-acetyl-3-methylthiophene |
|
| 상품명칭 | 2-acetyl-3-methylthiophene |
| 영문 이름 | 2-acetyl-3-methylthiophene;1-(3-methylthiophen-2-yl)ethanone;2-acetyl-3-methyl thiophene |
| 분자식 | C7H8OS |
| 분자량 | 140.2028 |
| InChI | InChI=1/C7H8OS/c1-5-3-4-9-7(5)6(2)8/h3-4H,1-2H3 |
| cas번호 | 13679-72-6 |
| EC번호 | 237-179-1 |
| 분자 구조 |  |
| 밀도 | 1.106g/cm3 |
| 비등점 | 214.9°C at 760 mmHg |
| 굴절 지수 | 1.535 |
| 인화점 | 92.3°C |
| 증기압 | 0.152mmHg at 25°C |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 