Chemindex > 1206-15-1
KR ▼
1206-15-1 1-(4-메톡시페닐)-1-사이클로펜탄카보니트릴 |
|
| 상품명칭 | 1-(4-메톡시페닐)-1-사이클로펜탄카보니트릴 |
| 별명 | 1-(4-메톡시페닐)사이클로펜탄카보니트릴 |
| 영문 이름 | 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile;1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
| 분자식 | C13H15NO |
| 분자량 | 201.2643 |
| InChI | InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| cas번호 | 1206-15-1 |
| EC번호 | 214-890-5 |
| 분자 구조 |  |
| 밀도 | 1.07g/cm3 |
| 비등점 | 346.4°C at 760 mmHg |
| 굴절 지수 | 1.543 |
| 인화점 | 146.2°C |
| 증기압 | 5.76E-05mmHg at 25°C |
| 위험성 표시 |  Xn##Harmful:; |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 