ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112-79-8 Elaidic acid |
|
상품명칭 | Elaidic acid |
영문 이름 | Elaidic acid;trans-9-Octadecenoic acid~trans-Oleic acid;trans-9-Octadecenic acid;(9E)-octadec-9-enoic acid |
분자식 | C18H34O2 |
분자량 | 282.4614 |
InChI | InChI=1/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9+ |
cas번호 | 112-79-8 |
EC번호 | 204-006-6 |
분자 구조 | ![]() |
밀도 | 0.899g/cm3 |
녹는 점 | 43-45℃ |
비등점 | 360°C at 760 mmHg |
굴절 지수 | 1.466 |
인화점 | 270.1°C |
증기압 | 3.7E-06mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |