ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
112-61-8 Methyl stearate |
|
상품명칭 | Methyl stearate |
영문 이름 | Methyl stearate;Methyl n-octadecanoate;Stearic acid methyl ester;methyl octadecanoate;Me-ST |
분자식 | C19H38O2 |
분자량 | 298.5038 |
InChI | InChI=1/C19H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h3-18H2,1-2H3 |
cas번호 | 112-61-8 |
EC번호 | 203-990-4 |
분자 구조 | |
밀도 | 0.863g/cm3 |
녹는 점 | 37-39℃ |
비등점 | 355.5°C at 760 mmHg |
굴절 지수 | 1.444 |
인화점 | 169.3°C |
증기압 | 3.11E-05mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |