ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
111-51-3 N,N,N',N'-Tetramethyl-1,4-butanediamine |
|
상품명칭 | N,N,N',N'-Tetramethyl-1,4-butanediamine |
영문 이름 | N,N,N',N'-Tetramethyl-1,4-butanediamine;Tetramethyldiaminobutane;N,N,N,N-tetramethyltetramethylenediamine;1,4-Bis-(dimethylamino)-butane;N,N,N?N?Tetramethyl-1,4-butane- diamine, [1,4-Bis(dimethylamino)butane];N,N,N',N'-tetramethylbutane-1,4-diaminium |
분자식 | C8H22N2 |
분자량 | 146.2726 |
InChI | InChI=1/C8H20N2/c1-9(2)7-5-6-8-10(3)4/h5-8H2,1-4H3/p+2 |
cas번호 | 111-51-3 |
EC번호 | 203-878-5 |
분자 구조 | ![]() |
녹는 점 | -100℃ |
비등점 | 169°C at 760 mmHg |
인화점 | 46.1°C |
증기압 | 1.57mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R10##Flammable.||R34##Causes burns.:; |
보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |