ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
111-21-7 Triethyleneglycoldiacetate |
|
상품명칭 | Triethyleneglycoldiacetate |
영문 이름 | Triethyleneglycoldiacetate;Triethylene glycol diacetate;ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
분자식 | C10H18O6 |
분자량 | 234.2463 |
InChI | InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
cas번호 | 111-21-7 |
EC번호 | 203-846-0 |
분자 구조 | |
밀도 | 1.098g/cm3 |
비등점 | 286°C at 760 mmHg |
굴절 지수 | 1.432 |
인화점 | 125.2°C |
증기압 | 0.00271mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |