ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
110-36-1 butyl myristate |
|
상품명칭 | butyl myristate |
영문 이름 | butyl myristate;n-Butyl myristate~Myristic acid n-butyl ester~Teradecanoic acid n-butyl ester;Myristicacidnbutylester;Myristic acid n-butyl ester;butyl tetradecanoate |
분자식 | C18H36O2 |
분자량 | 284.4772 |
InChI | InChI=1/C18H36O2/c1-3-5-7-8-9-10-11-12-13-14-15-16-18(19)20-17-6-4-2/h3-17H2,1-2H3 |
cas번호 | 110-36-1 |
EC번호 | 203-759-8 |
분자 구조 | |
밀도 | 0.864g/cm3 |
비등점 | 334.7°C at 760 mmHg |
굴절 지수 | 1.442 |
인화점 | 158.5°C |
증기압 | 0.000126mmHg at 25°C |
리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |