Chemindex > 107-85-7
KR ▼
107-85-7 Isoamylamine |
|
| 상품명칭 | Isoamylamine |
| 영문 이름 | Isoamylamine;3-Methyl-1-butanamine;Isopentylamine;3-Methylbutylamine;1-amino-3-methylbutane;3-methylbutan-1-amine;3-methylbutan-1-amine hydrochloride (1:1);3-methylbutan-1-aminium |
| 분자식 | C5H14N |
| 분자량 | 88.1708 |
| InChI | InChI=1/C5H13N/c1-5(2)3-4-6/h5H,3-4,6H2,1-2H3/p+1 |
| cas번호 | 107-85-7 |
| EC번호 | 203-526-0 |
| 분자 구조 |  |
| 녹는 점 | -60℃ |
| 비등점 | 92.7°C at 760 mmHg |
| 인화점 | 18.3°C |
| 증기압 | 51.1mmHg at 25°C |
| 위험성 표시 |  F##Highly flammable||C##Corrosive:; |
| 리스크 규칙 | R11##Highly flammable.||R34##Causes burns.:; |
| 보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 