ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
107-84-6 1-Chloro-3-methylbutane |
|
상품명칭 | 1-Chloro-3-methylbutane |
영문 이름 | 1-Chloro-3-methylbutane;Isoamyl chloride~Isopentyl chloride |
분자식 | C5H11Cl |
분자량 | 106.5938 |
InChI | InChI=1/C5H11Cl/c1-5(2)3-4-6/h5H,3-4H2,1-2H3 |
cas번호 | 107-84-6 |
EC번호 | 203-525-5 |
분자 구조 | ![]() |
밀도 | 0.867g/cm3 |
비등점 | 98.3°C at 760 mmHg |
굴절 지수 | 1.403 |
인화점 | 9.8°C |
증기압 | 46.2mmHg at 25°C |
리스크 규칙 | R11##Highly flammable.:; |
보안 규칙 | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |