p-Xylene |
|
상품명칭 | p-Xylene |
영문 이름 | p-Xylene;1,4-Dimethylbenzene;para-xylene;Dibencoside;1,4-xylene |
분자식 | C8H10 |
분자량 | 106.1674 |
InChI | InChI:1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3 |
cas번호 | 106-42-3 |
EC번호 | 203-396-5 |
분자 구조 | |
녹는 점 | 13-13℃ |
비등점 | 139.61°C at 760 mmHg |
인화점 | 24.627°C |
증기압 | 7.943mmHg at 25°C |
위험성 표시 | Xn##Harmful:; |
리스크 규칙 | R10##Flammable.||R20/21##Harmful by inhalation and in contact with skin.||R38##Irritating to skin.:; |
보안 규칙 | S25##Avoid contact with eyes.:; |
MSDS |