1,4-Cyclohexanedimethanol, mixture of cisand trans |
상품명칭 |
1,4-Cyclohexanedimethanol, mixture of cisand trans |
영문 이름 |
1,4-Cyclohexanedimethanol, mixture of cisand trans;1,4-Bis(hydroxymethyl)cyclohexane;cyclohex-1,4-ylenedimethanol;1,4-Cyclohexane dimethanol;cyclohexane-1,4-diyldimethanol;1,4-Cyclohexanedimethanol;CHDM |
분자식 |
C8H16O2 |
분자량 |
144.2114 |
InChI |
InChI=1/C8H16O2/c9-5-7-1-2-8(6-10)4-3-7/h7-10H,1-6H2 |
cas번호 |
105-08-8 |
EC번호 |
203-268-9 |
분자 구조 |
|
밀도 |
1.004g/cm3 |
녹는 점 |
31.5℃ |
비등점 |
286.2°C at 760 mmHg |
굴절 지수 |
1.47 |
인화점 |
161.1°C |
물 용해도 |
miscible |
증기압 |
0.000303mmHg at 25°C |
리스크 규칙 |
R36:;
|
보안 규칙 |
S26||S39:;
|
MSDS |
Material Safety Data Sheet |