Chemindex > 104-18-7
KR ▼
104-18-7 (4-Aminophenylthio)acetic acid |
|
| 상품명칭 | (4-Aminophenylthio)acetic acid |
| 영문 이름 | (4-Aminophenylthio)acetic acid;2-(4-Aminophenylthio)acetic acid;4-Aminothiophenoxyacetic acid;[(4-aminophenyl)sulfanyl]acetic acid;[(4-aminophenyl)sulfanyl]acetate |
| 분자식 | C8H8NO2S |
| 분자량 | 182.2202 |
| InChI | InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
| cas번호 | 104-18-7 |
| EC번호 | 203-182-1 |
| 분자 구조 |  |
| 비등점 | 405.3°C at 760 mmHg |
| 인화점 | 198.9°C |
| 증기압 | 2.69E-07mmHg at 25°C |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 