ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-78-6 cyclohexylacetone |
|
상품명칭 | cyclohexylacetone |
영문 이름 | cyclohexylacetone;Cyclohexylacetone, (Acetonylcyclohexane);Acetonylcyclohexane;Cyclohexyacetone;1-cyclohexylpropan-2-one;1-cyclohexylacetone |
분자식 | C9H16O |
분자량 | 140.2227 |
InChI | InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
cas번호 | 103-78-6 |
EC번호 | 203-143-9 |
분자 구조 | |
밀도 | 0.889g/cm3 |
비등점 | 188.1°C at 760 mmHg |
굴절 지수 | 1.441 |
인화점 | 65.3°C |
증기압 | 0.609mmHg at 25°C |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |