ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-55-9 N'-Benzyl-N,N-dimethylethylenediamine |
|
상품명칭 | N'-Benzyl-N,N-dimethylethylenediamine |
영문 이름 | N'-Benzyl-N,N-dimethylethylenediamine;2-benzylaminoethyldimethylamine;N?Benzyl-N,N-dimethylethylenediamine;N'-benzyl-N,N-dimethylethane-1,2-diamine;N'-benzyl-N,N-dimethylethane-1,2-diaminium |
분자식 | C11H20N2 |
분자량 | 180.2888 |
InChI | InChI=1/C11H18N2/c1-13(2)9-8-12-10-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/p+2 |
cas번호 | 103-55-9 |
EC번호 | 203-122-4 |
분자 구조 | ![]() |
비등점 | 254.7°C at 760 mmHg |
인화점 | 93.3°C |
증기압 | 0.017mmHg at 25°C |
위험성 표시 | |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S24/25##Avoid contact with skin and eyes.:; |
MSDS |