N'-Benzyl-N,N-dimethylethylenediamine |
상품명칭 |
N'-Benzyl-N,N-dimethylethylenediamine |
영문 이름 |
N'-Benzyl-N,N-dimethylethylenediamine;2-benzylaminoethyldimethylamine;N?Benzyl-N,N-dimethylethylenediamine;N'-benzyl-N,N-dimethylethane-1,2-diamine;N'-benzyl-N,N-dimethylethane-1,2-diaminium |
분자식 |
C11H20N2 |
분자량 |
180.2888 |
InChI |
InChI=1/C11H18N2/c1-13(2)9-8-12-10-11-6-4-3-5-7-11/h3-7,12H,8-10H2,1-2H3/p+2 |
cas번호 |
103-55-9 |
EC번호 |
203-122-4 |
분자 구조 |
|
비등점 |
254.7°C at 760 mmHg |
인화점 |
93.3°C |
증기압 |
0.017mmHg at 25°C |
위험성 표시 |
Xi##Irritant:;
|
리스크 규칙 |
R36/37/38##Irritating to eyes, respiratory system and skin.:;
|
보안 규칙 |
S24/25##Avoid contact with skin and eyes.:;
|
MSDS |
Material Safety Data Sheet |