ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-43-5 dibenzyl succinate |
|
상품명칭 | dibenzyl succinate |
영문 이름 | dibenzyl succinate;Dibenzyl succinate, (Succinic acid dibenzyl ester);Succinic acid dibenzyl ester;Butanedioic acid dibenzyl ester~Succinic acid dibenzyl ester;dibenzyl butanedioate |
분자식 | C18H18O4 |
분자량 | 298.3331 |
InChI | InChI=1/C18H18O4/c19-17(21-13-15-7-3-1-4-8-15)11-12-18(20)22-14-16-9-5-2-6-10-16/h1-10H,11-14H2 |
cas번호 | 103-43-5 |
EC번호 | 203-110-9 |
분자 구조 | |
밀도 | 1.165g/cm3 |
비등점 | 416.4°C at 760 mmHg |
굴절 지수 | 1.556 |
인화점 | 205.7°C |
증기압 | 3.82E-07mmHg at 25°C |
보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |