ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
102-39-6 m-phenylenedioxydi(acetic acid) |
|
상품명칭 | m-phenylenedioxydi(acetic acid) |
영문 이름 | m-phenylenedioxydi(acetic acid);Resorcinol-O,O-diacetic acid;1,3-Bis(carboxymethoxy)benzene;Resorcinol-O,O-diacetic acid;2,2'-[benzene-1,3-diylbis(oxy)]diacetic acid |
분자식 | C10H10O6 |
분자량 | 226.1828 |
InChI | InChI=1/C10H10O6/c11-9(12)5-15-7-2-1-3-8(4-7)16-6-10(13)14/h1-4H,5-6H2,(H,11,12)(H,13,14) |
cas번호 | 102-39-6 |
EC번호 | 203-027-8 |
분자 구조 | ![]() |
밀도 | 1.416g/cm3 |
비등점 | 447.4°C at 760 mmHg |
굴절 지수 | 1.564 |
인화점 | 180.4°C |
증기압 | 8.65E-09mmHg at 25°C |
리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |